Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 1205-17-0, Name is 2-Methyl-3-(3,4-methylenedioxyphenyl)propionaldehyde, SMILES is CC(CC1=CC2=C(OCO2)C=C1)C=O, belongs to pyrrolines compound. In a document, author is Basnet, Prakash, introduce the new discover, Recommanded Product: 1205-17-0.
Copper Catalyzed Oxidative Arylation of Tertiary Carbon Centers
We describe herein a Cu(OTf)(2) catalyzed oxidative arylation of a tertiary carbon-containing substrate including aryl malononitriles, 3-aryl benzofuran-2-ones, and 3-aryl oxindoles. In some cases, the nitrile groups of the aryl malononitriles undergo further reactions leading to lactones or imines. These reaction conditions are applicable for a range of arenes, including phenols, anilines, anisoles, and heteroarenes. Mechanistic studies support the formation of a cationic intermediate via a two-electron oxidation.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 1205-17-0 is helpful to your research. Recommanded Product: 1205-17-0.
Reference:
Pyrroline – Wikipedia,
,1-Pyrroline | C4H7N – PubChem