Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 29331-92-8, Name is 10-Hydroxy-10,11-dihydro-5H-dibenzo[b,f]azepine-5-carboxamide, SMILES is O=C(N1C2=CC=CC=C2CC(O)C3=CC=CC=C31)N, belongs to pyrrolines compound. In a document, author is Kalaitzakis, Dimitris, introduce the new discover, Formula: C15H14N2O2.
Methylene Blue as a Photosensitizer and Redox Agent: Synthesis of 5-Hydroxy-1H-pyrrol-2(5H)-ones from Furans
A highly efficient and general singlet-oxygen-initiated one-pot transformation of readily accessible furans into 5-hydroxy-1H-pyrrol-2(5H)-ones has been developed. The methodology was extended to the synthesis of other high-value ,-unsaturated -lactams. This useful set of transformations relies not only on the photosensitizing ability of methylene blue, but also on its redox properties: properties that have until now been virtually ignored in a synthetic context.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 29331-92-8 is helpful to your research. Formula: C15H14N2O2.
Reference:
Pyrroline – Wikipedia,
,1-Pyrroline | C4H7N – PubChem