Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, Category: pyrrolines, 163931-61-1, Name is Tetrabutylammonium difluorotriphenylsilicate(IV), SMILES is CCCC[N+](CCCC)(CCCC)CCCC.F[Si-](C1=CC=CC=C1)(C2=CC=CC=C2)(F)C3=CC=CC=C3, belongs to pyrrolines compound. In a document, author is Tsolomiti, Georgia, introduce the new discover.
An unexpected synthesis of 1,5,5-trisubstituted 3,4-dibromo-3-pyrrolin-2-ones from an open-chain tautomer gamma-ketoamide
The unexpected synthesis of 1,5,5-trisubstituted 3,4-dibromo-3-pyrrolin-2-ones 6, from the reaction of the 1-benzyl-5-phenyl-3,4,5-tribromo-3-pyrrolin-2-one 5, resulting from the reaction of 3benzoylpropionamide 1 using a threefold excess of bromine, with different nucleophiles, is described.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 163931-61-1 is helpful to your research. Category: pyrrolines.
Reference:
Pyrroline – Wikipedia,
,1-Pyrroline | C4H7N – PubChem